C18H22N6O — CID 156543163
N-(1-cyanopyrrolidin-3-yl)-3-[[[(3R)-1-cyanopyrrolidin-3-yl]amino]methyl]benzamide (PubChem CID 156543163) has the molecular formula C18H22N6O and a molecular weight of 338.41 g/mol. Its IUPAC name is N-(1-cyanopyrrolidin-3-yl)-3-[[[(3R)-1-cyanopyrrolidin-3-yl]amino]methyl]benzamide.
| Compound Name | N-(1-cyanopyrrolidin-3-yl)-3-[[[(3R)-1-cyanopyrrolidin-3-yl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 156543163 |
| Molecular Formula | C18H22N6O |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | N-(1-cyanopyrrolidin-3-yl)-3-[[[(3R)-1-cyanopyrrolidin-3-yl]amino]methyl]benzamide |
| SMILES | N#CN1CCC(NC(=O)c2cccc(CN[C@@H]3CCN(C#N)C3)c2)C1 |
| InChI | InChI=1S/C18H22N6O/c19-12-23-6-4-16(10-23)21-9-14-2-1-3-15(8-14)18(25)22-17-5-7-24(11-17)13-20/h1-3,8,16-17,21H,4-7,9-11H2,(H,22,25)/t16-,17?/m1/s1 |
| InChIKey | LGBYPDJYAGKOKK-TZHYSIJRSA-N |
| XLogP | 0.62 |
| TPSA | 95.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|