C18H16ClN3O — CID 175084708
3-chloro-N-(1-cyanopyrrolidin-3-yl)-4-phenylbenzamide (PubChem CID 175084708) has the molecular formula C18H16ClN3O and a molecular weight of 325.80 g/mol. Its IUPAC name is 3-chloro-N-(1-cyanopyrrolidin-3-yl)-4-phenylbenzamide.
| Compound Name | 3-chloro-N-(1-cyanopyrrolidin-3-yl)-4-phenylbenzamide |
|---|---|
| PubChem CID | 175084708 |
| Molecular Formula | C18H16ClN3O |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 3-chloro-N-(1-cyanopyrrolidin-3-yl)-4-phenylbenzamide |
| SMILES | N#CN1CCC(NC(=O)c2ccc(-c3ccccc3)c(Cl)c2)C1 |
| InChI | InChI=1S/C18H16ClN3O/c19-17-10-14(6-7-16(17)13-4-2-1-3-5-13)18(23)21-15-8-9-22(11-15)12-20/h1-7,10,15H,8-9,11H2,(H,21,23) |
| InChIKey | XNTKNRYNYJWKEF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|