C14H14N6O — CID 122590667
N-(1-cyanopyrrolidin-3-yl)-3-pyridin-3-yl-1H-pyrazole-5-carboxamide (PubChem CID 122590667) has the molecular formula C14H14N6O and a molecular weight of 282.31 g/mol. Its IUPAC name is N-(1-cyanopyrrolidin-3-yl)-3-pyridin-3-yl-1H-pyrazole-5-carboxamide.
| Compound Name | N-(1-cyanopyrrolidin-3-yl)-3-pyridin-3-yl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 122590667 |
| Molecular Formula | C14H14N6O |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | N-(1-cyanopyrrolidin-3-yl)-3-pyridin-3-yl-1H-pyrazole-5-carboxamide |
| SMILES | N#CN1CCC(NC(=O)c2cc(-c3cccnc3)n[nH]2)C1 |
| InChI | InChI=1S/C14H14N6O/c15-9-20-5-3-11(8-20)17-14(21)13-6-12(18-19-13)10-2-1-4-16-7-10/h1-2,4,6-7,11H,3,5,8H2,(H,17,21)(H,18,19) |
| InChIKey | HCGZNXDPBZKYNW-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 97.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|