C16H15N5O — CID 122590469
N-(1-cyanopyrrolidin-3-yl)-5-phenylpyrimidine-2-carboxamide (PubChem CID 122590469) has the molecular formula C16H15N5O and a molecular weight of 293.33 g/mol. Its IUPAC name is N-(1-cyanopyrrolidin-3-yl)-5-phenylpyrimidine-2-carboxamide.
| Compound Name | N-(1-cyanopyrrolidin-3-yl)-5-phenylpyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 122590469 |
| Molecular Formula | C16H15N5O |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | N-(1-cyanopyrrolidin-3-yl)-5-phenylpyrimidine-2-carboxamide |
| SMILES | N#CN1CCC(NC(=O)c2ncc(-c3ccccc3)cn2)C1 |
| InChI | InChI=1S/C16H15N5O/c17-11-21-7-6-14(10-21)20-16(22)15-18-8-13(9-19-15)12-4-2-1-3-5-12/h1-5,8-9,14H,6-7,10H2,(H,20,22) |
| InChIKey | QEHDEJVTUAFCHT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|