C35H34N8O2 — CID 158611434
N-(1-cyanopyrrolidin-3-yl)-N-methyl-4-phenylbenzamide;N-(1-cyanopyrrolidin-3-yl)-5-phenylpyridazine-3-carboxamide (PubChem CID 158611434) has the molecular formula C35H34N8O2 and a molecular weight of 598.71 g/mol. Its IUPAC name is N-(1-cyanopyrrolidin-3-yl)-N-methyl-4-phenylbenzamide;N-(1-cyanopyrrolidin-3-yl)-5-phenylpyridazine-3-carboxamide.
| Compound Name | N-(1-cyanopyrrolidin-3-yl)-N-methyl-4-phenylbenzamide;N-(1-cyanopyrrolidin-3-yl)-5-phenylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 158611434 |
| Molecular Formula | C35H34N8O2 |
| Molecular Weight | 598.71 g/mol |
| Exact Mass | 598.28 |
| IUPAC Name | N-(1-cyanopyrrolidin-3-yl)-N-methyl-4-phenylbenzamide;N-(1-cyanopyrrolidin-3-yl)-5-phenylpyridazine-3-carboxamide |
| SMILES | CN(C(=O)c1ccc(-c2ccccc2)cc1)C1CCN(C#N)C1.N#CN1CCC(NC(=O)c2cc(-c3ccccc3)cnn2)C1 |
| InChI | InChI=1S/C19H19N3O.C16H15N5O/c1-21(18-11-12-22(13-18)14-20)19(23)17-9-7-16(8-10-17)15-5-3-2-4-6-15;17-11-21-7-6-14(10-21)19-16(22)15-8-13(9-18-20-15)12-4-2-1-3-5-12/h2-10,18H,11-13H2,1H3;1-5,8-9,14H,6-7,10H2,(H,19,22) |
| InChIKey | HWWQODXHRFRMBX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 129.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.71 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|