C18H18N4O — CID 130345313
(3S)-1-cyano-N-methyl-N-(5-phenyl-2-pyridinyl)pyrrolidine-3-carboxamide (PubChem CID 130345313) has the molecular formula C18H18N4O and a molecular weight of 306.37 g/mol. Its IUPAC name is (3S)-1-cyano-N-methyl-N-(5-phenyl-2-pyridinyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-cyano-N-methyl-N-(5-phenyl-2-pyridinyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 130345313 |
| Molecular Formula | C18H18N4O |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | (3S)-1-cyano-N-methyl-N-(5-phenyl-2-pyridinyl)pyrrolidine-3-carboxamide |
| SMILES | CN(C(=O)[C@H]1CCN(C#N)C1)c1ccc(-c2ccccc2)cn1 |
| InChI | InChI=1S/C18H18N4O/c1-21(18(23)16-9-10-22(12-16)13-19)17-8-7-15(11-20-17)14-5-3-2-4-6-14/h2-8,11,16H,9-10,12H2,1H3/t16-/m0/s1 |
| InChIKey | HYZVZPBRRRGWMC-INIZCTEOSA-N |
| XLogP | 2.51 |
| TPSA | 60.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|