C14H13N5OS — CID 118981045
1-cyano-N-(5-phenyl-1,3,4-thiadiazol-2-yl)pyrrolidine-3-carboxamide (PubChem CID 118981045) has the molecular formula C14H13N5OS and a molecular weight of 299.36 g/mol. Its IUPAC name is 1-cyano-N-(5-phenyl-1,3,4-thiadiazol-2-yl)pyrrolidine-3-carboxamide.
| Compound Name | 1-cyano-N-(5-phenyl-1,3,4-thiadiazol-2-yl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 118981045 |
| Molecular Formula | C14H13N5OS |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 1-cyano-N-(5-phenyl-1,3,4-thiadiazol-2-yl)pyrrolidine-3-carboxamide |
| SMILES | N#CN1CCC(C(=O)Nc2nnc(-c3ccccc3)s2)C1 |
| InChI | InChI=1S/C14H13N5OS/c15-9-19-7-6-11(8-19)12(20)16-14-18-17-13(21-14)10-4-2-1-3-5-10/h1-5,11H,6-8H2,(H,16,18,20) |
| InChIKey | HOBDMDYUKBFZLF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|