C16H13N5OS — CID 118980961
1-cyano-N-[5-(3-cyanophenyl)-1,3-thiazol-2-yl]pyrrolidine-3-carboxamide (PubChem CID 118980961) has the molecular formula C16H13N5OS and a molecular weight of 323.38 g/mol. Its IUPAC name is 1-cyano-N-[5-(3-cyanophenyl)-1,3-thiazol-2-yl]pyrrolidine-3-carboxamide.
| Compound Name | 1-cyano-N-[5-(3-cyanophenyl)-1,3-thiazol-2-yl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 118980961 |
| Molecular Formula | C16H13N5OS |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 1-cyano-N-[5-(3-cyanophenyl)-1,3-thiazol-2-yl]pyrrolidine-3-carboxamide |
| SMILES | N#Cc1cccc(-c2cnc(NC(=O)C3CCN(C#N)C3)s2)c1 |
| InChI | InChI=1S/C16H13N5OS/c17-7-11-2-1-3-12(6-11)14-8-19-16(23-14)20-15(22)13-4-5-21(9-13)10-18/h1-3,6,8,13H,4-5,9H2,(H,19,20,22) |
| InChIKey | JGLPVWJSNSWFMS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 92.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|