C18H15N3OS — CID 155644150
(3S)-1-ethynyl-N-[5-(4-ethynylphenyl)-1,3-thiazol-2-yl]pyrrolidine-3-carboxamide (PubChem CID 155644150) has the molecular formula C18H15N3OS and a molecular weight of 321.41 g/mol. Its IUPAC name is (3S)-1-ethynyl-N-[5-(4-ethynylphenyl)-1,3-thiazol-2-yl]pyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-ethynyl-N-[5-(4-ethynylphenyl)-1,3-thiazol-2-yl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 155644150 |
| Molecular Formula | C18H15N3OS |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | (3S)-1-ethynyl-N-[5-(4-ethynylphenyl)-1,3-thiazol-2-yl]pyrrolidine-3-carboxamide |
| SMILES | C#Cc1ccc(-c2cnc(NC(=O)[C@H]3CCN(C#C)C3)s2)cc1 |
| InChI | InChI=1S/C18H15N3OS/c1-3-13-5-7-14(8-6-13)16-11-19-18(23-16)20-17(22)15-9-10-21(4-2)12-15/h1-2,5-8,11,15H,9-10,12H2,(H,19,20,22)/t15-/m0/s1 |
| InChIKey | HNMPASVCDQADSY-HNNXBMFYSA-N |
| XLogP | 2.64 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|