C16H13F3N4OS — CID 118980931
(3S)-1-cyano-N-[5-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]pyrrolidine-3-carboxamide (PubChem CID 118980931) has the molecular formula C16H13F3N4OS and a molecular weight of 366.37 g/mol. Its IUPAC name is (3S)-1-cyano-N-[5-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]pyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-cyano-N-[5-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 118980931 |
| Molecular Formula | C16H13F3N4OS |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | (3S)-1-cyano-N-[5-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]pyrrolidine-3-carboxamide |
| SMILES | N#CN1CC[C@H](C(=O)Nc2ncc(-c3ccc(C(F)(F)F)cc3)s2)C1 |
| InChI | InChI=1S/C16H13F3N4OS/c17-16(18,19)12-3-1-10(2-4-12)13-7-21-15(25-13)22-14(24)11-5-6-23(8-11)9-20/h1-4,7,11H,5-6,8H2,(H,21,22,24)/t11-/m0/s1 |
| InChIKey | HRLYUMRYZYZSSN-NSHDSACASA-N |
| XLogP | 3.57 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|