C15H17N5O2S — CID 56808851
1-N-(5-phenyl-1,3,4-thiadiazol-2-yl)piperidine-1,4-dicarboxamide (PubChem CID 56808851) has the molecular formula C15H17N5O2S and a molecular weight of 331.40 g/mol. Its IUPAC name is 1-N-(5-phenyl-1,3,4-thiadiazol-2-yl)piperidine-1,4-dicarboxamide.
| Compound Name | 1-N-(5-phenyl-1,3,4-thiadiazol-2-yl)piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 56808851 |
| Molecular Formula | C15H17N5O2S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 1-N-(5-phenyl-1,3,4-thiadiazol-2-yl)piperidine-1,4-dicarboxamide |
| SMILES | NC(=O)C1CCN(C(=O)Nc2nnc(-c3ccccc3)s2)CC1 |
| InChI | InChI=1S/C15H17N5O2S/c16-12(21)10-6-8-20(9-7-10)15(22)17-14-19-18-13(23-14)11-4-2-1-3-5-11/h1-5,10H,6-9H2,(H2,16,21)(H,17,19,22) |
| InChIKey | JGCNSIIHUKJTIM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |