C18H15F3N4O2 — CID 168909159
N-(1-cyanopyrrolidin-3-yl)-4-[3-(trifluoromethoxy)phenyl]pyridine-2-carboxamide (PubChem CID 168909159) has the molecular formula C18H15F3N4O2 and a molecular weight of 376.34 g/mol. Its IUPAC name is N-(1-cyanopyrrolidin-3-yl)-4-[3-(trifluoromethoxy)phenyl]pyridine-2-carboxamide.
| Compound Name | N-(1-cyanopyrrolidin-3-yl)-4-[3-(trifluoromethoxy)phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 168909159 |
| Molecular Formula | C18H15F3N4O2 |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | N-(1-cyanopyrrolidin-3-yl)-4-[3-(trifluoromethoxy)phenyl]pyridine-2-carboxamide |
| SMILES | N#CN1CCC(NC(=O)c2cc(-c3cccc(OC(F)(F)F)c3)ccn2)C1 |
| InChI | InChI=1S/C18H15F3N4O2/c19-18(20,21)27-15-3-1-2-12(8-15)13-4-6-23-16(9-13)17(26)24-14-5-7-25(10-14)11-22/h1-4,6,8-9,14H,5,7,10H2,(H,24,26) |
| InChIKey | WRLOWQBEIPMSRJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|