C18H16F3N5O3 — CID 168909039
N-(1-cyanopyrrolidin-3-yl)-5-[2-cyclopropyl-5-(trifluoromethoxy)phenyl]-1,2,4-oxadiazole-3-carboxamide (PubChem CID 168909039) has the molecular formula C18H16F3N5O3 and a molecular weight of 407.35 g/mol. Its IUPAC name is N-(1-cyanopyrrolidin-3-yl)-5-[2-cyclopropyl-5-(trifluoromethoxy)phenyl]-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | N-(1-cyanopyrrolidin-3-yl)-5-[2-cyclopropyl-5-(trifluoromethoxy)phenyl]-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 168909039 |
| Molecular Formula | C18H16F3N5O3 |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | N-(1-cyanopyrrolidin-3-yl)-5-[2-cyclopropyl-5-(trifluoromethoxy)phenyl]-1,2,4-oxadiazole-3-carboxamide |
| SMILES | N#CN1CCC(NC(=O)c2noc(-c3cc(OC(F)(F)F)ccc3C3CC3)n2)C1 |
| InChI | InChI=1S/C18H16F3N5O3/c19-18(20,21)28-12-3-4-13(10-1-2-10)14(7-12)17-24-15(25-29-17)16(27)23-11-5-6-26(8-11)9-22/h3-4,7,10-11H,1-2,5-6,8H2,(H,23,27) |
| InChIKey | DAXNATGFZPSBRX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|