C19H17N5O2 — CID 168909070
5-(5-cyano-2-cyclopropylphenyl)-N-(1-cyanopyrrolidin-3-yl)-1,3-oxazole-2-carboxamide (PubChem CID 168909070) has the molecular formula C19H17N5O2 and a molecular weight of 347.38 g/mol. Its IUPAC name is 5-(5-cyano-2-cyclopropylphenyl)-N-(1-cyanopyrrolidin-3-yl)-1,3-oxazole-2-carboxamide.
| Compound Name | 5-(5-cyano-2-cyclopropylphenyl)-N-(1-cyanopyrrolidin-3-yl)-1,3-oxazole-2-carboxamide |
|---|---|
| PubChem CID | 168909070 |
| Molecular Formula | C19H17N5O2 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 5-(5-cyano-2-cyclopropylphenyl)-N-(1-cyanopyrrolidin-3-yl)-1,3-oxazole-2-carboxamide |
| SMILES | N#Cc1ccc(C2CC2)c(-c2cnc(C(=O)NC3CCN(C#N)C3)o2)c1 |
| InChI | InChI=1S/C19H17N5O2/c20-8-12-1-4-15(13-2-3-13)16(7-12)17-9-22-19(26-17)18(25)23-14-5-6-24(10-14)11-21/h1,4,7,9,13-14H,2-3,5-6,10H2,(H,23,25) |
| InChIKey | XYPOBEIWVPOQMU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 105.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|