C21H19N9O2 — CID 168909222
5-(5-cyano-2-cyclopropylphenyl)-N-[(3R,5S)-1-cyano-5-(triazol-1-ylmethyl)pyrrolidin-3-yl]-1,3,4-oxadiazole-2-carboxamide (PubChem CID 168909222) has the molecular formula C21H19N9O2 and a molecular weight of 429.44 g/mol. Its IUPAC name is 5-(5-cyano-2-cyclopropylphenyl)-N-[(3R,5S)-1-cyano-5-(triazol-1-ylmethyl)pyrrolidin-3-yl]-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | 5-(5-cyano-2-cyclopropylphenyl)-N-[(3R,5S)-1-cyano-5-(triazol-1-ylmethyl)pyrrolidin-3-yl]-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 168909222 |
| Molecular Formula | C21H19N9O2 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 5-(5-cyano-2-cyclopropylphenyl)-N-[(3R,5S)-1-cyano-5-(triazol-1-ylmethyl)pyrrolidin-3-yl]-1,3,4-oxadiazole-2-carboxamide |
| SMILES | N#Cc1ccc(C2CC2)c(-c2nnc(C(=O)N[C@@H]3C[C@@H](Cn4ccnn4)N(C#N)C3)o2)c1 |
| InChI | InChI=1S/C21H19N9O2/c22-9-13-1-4-17(14-2-3-14)18(7-13)20-26-27-21(32-20)19(31)25-15-8-16(29(10-15)12-23)11-30-6-5-24-28-30/h1,4-7,14-16H,2-3,8,10-11H2,(H,25,31)/t15-,16+/m1/s1 |
| InChIKey | YVSMDORCCRBFGM-CVEARBPZSA-N |
| XLogP | 1.43 |
| TPSA | 149.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|