C17H22FN5O2 — CID 134363537
N-(1-cyanopyrrolidin-3-yl)-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-fluoropyridine-4-carboxamide (PubChem CID 134363537) has the molecular formula C17H22FN5O2 and a molecular weight of 347.39 g/mol. Its IUPAC name is N-(1-cyanopyrrolidin-3-yl)-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-fluoropyridine-4-carboxamide.
| Compound Name | N-(1-cyanopyrrolidin-3-yl)-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 134363537 |
| Molecular Formula | C17H22FN5O2 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | N-(1-cyanopyrrolidin-3-yl)-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-fluoropyridine-4-carboxamide |
| SMILES | C[C@@H]1CN(c2cc(C(=O)NC3CCN(C#N)C3)c(F)cn2)C[C@H](C)O1 |
| InChI | InChI=1S/C17H22FN5O2/c1-11-7-23(8-12(2)25-11)16-5-14(15(18)6-20-16)17(24)21-13-3-4-22(9-13)10-19/h5-6,11-13H,3-4,7-9H2,1-2H3,(H,21,24)/t11-,12+,13? |
| InChIKey | ODHVPYGBIHZJLO-FUNVUKJBSA-N |
| XLogP | 1.12 |
| TPSA | 81.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|