C17H15F2N5O — CID 122590417
N-(1-cyanopyrrolidin-3-yl)-2-fluoro-4-(5-fluoro-2-methylpyrimidin-4-yl)benzamide (PubChem CID 122590417) has the molecular formula C17H15F2N5O and a molecular weight of 343.34 g/mol. Its IUPAC name is N-(1-cyanopyrrolidin-3-yl)-2-fluoro-4-(5-fluoro-2-methylpyrimidin-4-yl)benzamide.
| Compound Name | N-(1-cyanopyrrolidin-3-yl)-2-fluoro-4-(5-fluoro-2-methylpyrimidin-4-yl)benzamide |
|---|---|
| PubChem CID | 122590417 |
| Molecular Formula | C17H15F2N5O |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | N-(1-cyanopyrrolidin-3-yl)-2-fluoro-4-(5-fluoro-2-methylpyrimidin-4-yl)benzamide |
| SMILES | Cc1ncc(F)c(-c2ccc(C(=O)NC3CCN(C#N)C3)c(F)c2)n1 |
| InChI | InChI=1S/C17H15F2N5O/c1-10-21-7-15(19)16(22-10)11-2-3-13(14(18)6-11)17(25)23-12-4-5-24(8-12)9-20/h2-3,6-7,12H,4-5,8H2,1H3,(H,23,25) |
| InChIKey | XYKCKEKCKGZVMC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|