C17H16FN5O — CID 122590548
N-(1-cyanopyrrolidin-3-yl)-2-fluoro-4-(2-methylpyrimidin-4-yl)benzamide (PubChem CID 122590548) has the molecular formula C17H16FN5O and a molecular weight of 325.35 g/mol. Its IUPAC name is N-(1-cyanopyrrolidin-3-yl)-2-fluoro-4-(2-methylpyrimidin-4-yl)benzamide.
| Compound Name | N-(1-cyanopyrrolidin-3-yl)-2-fluoro-4-(2-methylpyrimidin-4-yl)benzamide |
|---|---|
| PubChem CID | 122590548 |
| Molecular Formula | C17H16FN5O |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | N-(1-cyanopyrrolidin-3-yl)-2-fluoro-4-(2-methylpyrimidin-4-yl)benzamide |
| SMILES | Cc1nccc(-c2ccc(C(=O)NC3CCN(C#N)C3)c(F)c2)n1 |
| InChI | InChI=1S/C17H16FN5O/c1-11-20-6-4-16(21-11)12-2-3-14(15(18)8-12)17(24)22-13-5-7-23(9-13)10-19/h2-4,6,8,13H,5,7,9H2,1H3,(H,22,24) |
| InChIKey | QMXNMZVWAITDFL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|