C16H15FN6O — CID 122590464
N-[(3R)-1-cyanopyrrolidin-3-yl]-2-fluoro-4-(pyrimidin-2-ylamino)benzamide (PubChem CID 122590464) has the molecular formula C16H15FN6O and a molecular weight of 326.33 g/mol. Its IUPAC name is N-[(3R)-1-cyanopyrrolidin-3-yl]-2-fluoro-4-(pyrimidin-2-ylamino)benzamide.
| Compound Name | N-[(3R)-1-cyanopyrrolidin-3-yl]-2-fluoro-4-(pyrimidin-2-ylamino)benzamide |
|---|---|
| PubChem CID | 122590464 |
| Molecular Formula | C16H15FN6O |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | N-[(3R)-1-cyanopyrrolidin-3-yl]-2-fluoro-4-(pyrimidin-2-ylamino)benzamide |
| SMILES | N#CN1CC[C@@H](NC(=O)c2ccc(Nc3ncccn3)cc2F)C1 |
| InChI | InChI=1S/C16H15FN6O/c17-14-8-11(22-16-19-5-1-6-20-16)2-3-13(14)15(24)21-12-4-7-23(9-12)10-18/h1-3,5-6,8,12H,4,7,9H2,(H,21,24)(H,19,20,22)/t12-/m1/s1 |
| InChIKey | PURMXILRTAGUHU-GFCCVEGCSA-N |
| XLogP | 1.64 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|