C20H18FN5O — CID 122590619
N-[(3R)-1-cyanopyrrolidin-3-yl]-2-fluoro-4-(1-methylindazol-5-yl)benzamide (PubChem CID 122590619) has the molecular formula C20H18FN5O and a molecular weight of 363.40 g/mol. Its IUPAC name is N-[(3R)-1-cyanopyrrolidin-3-yl]-2-fluoro-4-(1-methylindazol-5-yl)benzamide.
| Compound Name | N-[(3R)-1-cyanopyrrolidin-3-yl]-2-fluoro-4-(1-methylindazol-5-yl)benzamide |
|---|---|
| PubChem CID | 122590619 |
| Molecular Formula | C20H18FN5O |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | N-[(3R)-1-cyanopyrrolidin-3-yl]-2-fluoro-4-(1-methylindazol-5-yl)benzamide |
| SMILES | Cn1ncc2cc(-c3ccc(C(=O)N[C@@H]4CCN(C#N)C4)c(F)c3)ccc21 |
| InChI | InChI=1S/C20H18FN5O/c1-25-19-5-3-13(8-15(19)10-23-25)14-2-4-17(18(21)9-14)20(27)24-16-6-7-26(11-16)12-22/h2-5,8-10,16H,6-7,11H2,1H3,(H,24,27)/t16-/m1/s1 |
| InChIKey | CEBODDRYMRREQK-MRXNPFEDSA-N |
| XLogP | 2.66 |
| TPSA | 73.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|