C16H19FN4O — CID 122590391
N-(1-cyanopyrrolidin-3-yl)-2-fluoro-4-pyrrolidin-1-ylbenzamide (PubChem CID 122590391) has the molecular formula C16H19FN4O and a molecular weight of 302.35 g/mol. Its IUPAC name is N-(1-cyanopyrrolidin-3-yl)-2-fluoro-4-pyrrolidin-1-ylbenzamide.
| Compound Name | N-(1-cyanopyrrolidin-3-yl)-2-fluoro-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 122590391 |
| Molecular Formula | C16H19FN4O |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | N-(1-cyanopyrrolidin-3-yl)-2-fluoro-4-pyrrolidin-1-ylbenzamide |
| SMILES | N#CN1CCC(NC(=O)c2ccc(N3CCCC3)cc2F)C1 |
| InChI | InChI=1S/C16H19FN4O/c17-15-9-13(21-6-1-2-7-21)3-4-14(15)16(22)19-12-5-8-20(10-12)11-18/h3-4,9,12H,1-2,5-8,10H2,(H,19,22) |
| InChIKey | WALBHSXBGAUZKG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|