C21H11FIN5 — CID 169103121
2-(4-cyano-3-fluorophenyl)-6-iodo-3-(1-methylindazol-5-yl)pyridine-4-carbonitrile (PubChem CID 169103121) has the molecular formula C21H11FIN5 and a molecular weight of 479.26 g/mol. Its IUPAC name is 2-(4-cyano-3-fluorophenyl)-6-iodo-3-(1-methylindazol-5-yl)pyridine-4-carbonitrile.
| Compound Name | 2-(4-cyano-3-fluorophenyl)-6-iodo-3-(1-methylindazol-5-yl)pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 169103121 |
| Molecular Formula | C21H11FIN5 |
| Molecular Weight | 479.26 g/mol |
| Exact Mass | 479.00 |
| IUPAC Name | 2-(4-cyano-3-fluorophenyl)-6-iodo-3-(1-methylindazol-5-yl)pyridine-4-carbonitrile |
| SMILES | Cn1ncc2cc(-c3c(C#N)cc(I)nc3-c3ccc(C#N)c(F)c3)ccc21 |
| InChI | InChI=1S/C21H11FIN5/c1-28-18-5-4-12(6-16(18)11-26-28)20-15(10-25)8-19(23)27-21(20)13-2-3-14(9-24)17(22)7-13/h2-8,11H,1H3 |
| InChIKey | WWEFDCVRKBFHBW-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 78.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.26 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|