C20H10F2IN3O — CID 176754512
2-(3-fluoro-4-isocyanophenyl)-3-(3-fluoro-4-methoxyphenyl)-6-iodopyridine-4-carbonitrile (PubChem CID 176754512) has the molecular formula C20H10F2IN3O and a molecular weight of 473.22 g/mol. Its IUPAC name is 2-(3-fluoro-4-isocyanophenyl)-3-(3-fluoro-4-methoxyphenyl)-6-iodopyridine-4-carbonitrile.
| Compound Name | 2-(3-fluoro-4-isocyanophenyl)-3-(3-fluoro-4-methoxyphenyl)-6-iodopyridine-4-carbonitrile |
|---|---|
| PubChem CID | 176754512 |
| Molecular Formula | C20H10F2IN3O |
| Molecular Weight | 473.22 g/mol |
| Exact Mass | 472.98 |
| IUPAC Name | 2-(3-fluoro-4-isocyanophenyl)-3-(3-fluoro-4-methoxyphenyl)-6-iodopyridine-4-carbonitrile |
| SMILES | [C-]#[N+]c1ccc(-c2nc(I)cc(C#N)c2-c2ccc(OC)c(F)c2)cc1F |
| InChI | InChI=1S/C20H10F2IN3O/c1-25-16-5-3-12(8-14(16)21)20-19(13(10-24)9-18(23)26-20)11-4-6-17(27-2)15(22)7-11/h3-9H,2H3 |
| InChIKey | QTRFXLZHAFPPJE-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.22 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|