C24H22F2N4O3 — CID 123319461
6-(3-fluoro-4-isocyanophenyl)-5-(3-fluoro-4-methoxyphenyl)-3-methyl-2-(pyrrolidin-2-ylmethoxy)pyrimidin-4-one (PubChem CID 123319461) has the molecular formula C24H22F2N4O3 and a molecular weight of 452.46 g/mol. Its IUPAC name is 6-(3-fluoro-4-isocyanophenyl)-5-(3-fluoro-4-methoxyphenyl)-3-methyl-2-(pyrrolidin-2-ylmethoxy)pyrimidin-4-one.
| Compound Name | 6-(3-fluoro-4-isocyanophenyl)-5-(3-fluoro-4-methoxyphenyl)-3-methyl-2-(pyrrolidin-2-ylmethoxy)pyrimidin-4-one |
|---|---|
| PubChem CID | 123319461 |
| Molecular Formula | C24H22F2N4O3 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 6-(3-fluoro-4-isocyanophenyl)-5-(3-fluoro-4-methoxyphenyl)-3-methyl-2-(pyrrolidin-2-ylmethoxy)pyrimidin-4-one |
| SMILES | [C-]#[N+]c1ccc(-c2nc(OCC3CCCN3)n(C)c(=O)c2-c2ccc(OC)c(F)c2)cc1F |
| InChI | InChI=1S/C24H22F2N4O3/c1-27-19-8-6-15(12-17(19)25)22-21(14-7-9-20(32-3)18(26)11-14)23(31)30(2)24(29-22)33-13-16-5-4-10-28-16/h6-9,11-12,16,28H,4-5,10,13H2,2-3H3 |
| InChIKey | MOTGCDHUHFLCJT-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 69.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|