C25H24F2N4O2 — CID 153041521
6-(3-fluoro-4-isocyanophenyl)-5-(3-fluoro-4-methoxyphenyl)-3-methyl-2-(2-pyrrolidin-3-ylethyl)pyrimidin-4-one (PubChem CID 153041521) has the molecular formula C25H24F2N4O2 and a molecular weight of 450.49 g/mol. Its IUPAC name is 6-(3-fluoro-4-isocyanophenyl)-5-(3-fluoro-4-methoxyphenyl)-3-methyl-2-(2-pyrrolidin-3-ylethyl)pyrimidin-4-one.
| Compound Name | 6-(3-fluoro-4-isocyanophenyl)-5-(3-fluoro-4-methoxyphenyl)-3-methyl-2-(2-pyrrolidin-3-ylethyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 153041521 |
| Molecular Formula | C25H24F2N4O2 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 6-(3-fluoro-4-isocyanophenyl)-5-(3-fluoro-4-methoxyphenyl)-3-methyl-2-(2-pyrrolidin-3-ylethyl)pyrimidin-4-one |
| SMILES | [C-]#[N+]c1ccc(-c2nc(CCC3CCNC3)n(C)c(=O)c2-c2ccc(OC)c(F)c2)cc1F |
| InChI | InChI=1S/C25H24F2N4O2/c1-28-20-7-5-17(13-18(20)26)24-23(16-6-8-21(33-3)19(27)12-16)25(32)31(2)22(30-24)9-4-15-10-11-29-14-15/h5-8,12-13,15,29H,4,9-11,14H2,2-3H3 |
| InChIKey | VFTZRTORRUYDPW-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 60.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|