C27H29FN4O2 — CID 148545837
2-[2-(azepan-4-yl)ethyl]-6-(3-fluoro-4-isocyanophenyl)-5-(4-methoxyphenyl)-3-methylpyrimidin-4-one (PubChem CID 148545837) has the molecular formula C27H29FN4O2 and a molecular weight of 460.55 g/mol. Its IUPAC name is 2-[2-(azepan-4-yl)ethyl]-6-(3-fluoro-4-isocyanophenyl)-5-(4-methoxyphenyl)-3-methylpyrimidin-4-one.
| Compound Name | 2-[2-(azepan-4-yl)ethyl]-6-(3-fluoro-4-isocyanophenyl)-5-(4-methoxyphenyl)-3-methylpyrimidin-4-one |
|---|---|
| PubChem CID | 148545837 |
| Molecular Formula | C27H29FN4O2 |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | 2-[2-(azepan-4-yl)ethyl]-6-(3-fluoro-4-isocyanophenyl)-5-(4-methoxyphenyl)-3-methylpyrimidin-4-one |
| SMILES | [C-]#[N+]c1ccc(-c2nc(CCC3CCCNCC3)n(C)c(=O)c2-c2ccc(OC)cc2)cc1F |
| InChI | InChI=1S/C27H29FN4O2/c1-29-23-12-9-20(17-22(23)28)26-25(19-7-10-21(34-3)11-8-19)27(33)32(2)24(31-26)13-6-18-5-4-15-30-16-14-18/h7-12,17-18,30H,4-6,13-16H2,2-3H3 |
| InChIKey | MTBMXKKNQXPDSC-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 60.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|