C26H28FN5O3 — CID 123509744
2-(4-aminopiperidin-1-yl)-3-ethyl-6-(3-fluoro-4-isocyanophenyl)-5-[4-(2-hydroxyethoxy)phenyl]pyrimidin-4-one (PubChem CID 123509744) has the molecular formula C26H28FN5O3 and a molecular weight of 477.54 g/mol. Its IUPAC name is 2-(4-aminopiperidin-1-yl)-3-ethyl-6-(3-fluoro-4-isocyanophenyl)-5-[4-(2-hydroxyethoxy)phenyl]pyrimidin-4-one.
| Compound Name | 2-(4-aminopiperidin-1-yl)-3-ethyl-6-(3-fluoro-4-isocyanophenyl)-5-[4-(2-hydroxyethoxy)phenyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 123509744 |
| Molecular Formula | C26H28FN5O3 |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | 2-(4-aminopiperidin-1-yl)-3-ethyl-6-(3-fluoro-4-isocyanophenyl)-5-[4-(2-hydroxyethoxy)phenyl]pyrimidin-4-one |
| SMILES | [C-]#[N+]c1ccc(-c2nc(N3CCC(N)CC3)n(CC)c(=O)c2-c2ccc(OCCO)cc2)cc1F |
| InChI | InChI=1S/C26H28FN5O3/c1-3-32-25(34)23(17-4-7-20(8-5-17)35-15-14-33)24(18-6-9-22(29-2)21(27)16-18)30-26(32)31-12-10-19(28)11-13-31/h4-9,16,19,33H,3,10-15,28H2,1H3 |
| InChIKey | DOLKEKQYNICBRB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|