C22H24FN5O — CID 123710149
2-(4-aminopiperidin-1-yl)-6-(3-fluoro-4-isocyanophenyl)-3-methyl-5-(3-methylbut-1-ynyl)pyrimidin-4-one (PubChem CID 123710149) has the molecular formula C22H24FN5O and a molecular weight of 393.47 g/mol. Its IUPAC name is 2-(4-aminopiperidin-1-yl)-6-(3-fluoro-4-isocyanophenyl)-3-methyl-5-(3-methylbut-1-ynyl)pyrimidin-4-one.
| Compound Name | 2-(4-aminopiperidin-1-yl)-6-(3-fluoro-4-isocyanophenyl)-3-methyl-5-(3-methylbut-1-ynyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 123710149 |
| Molecular Formula | C22H24FN5O |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | 2-(4-aminopiperidin-1-yl)-6-(3-fluoro-4-isocyanophenyl)-3-methyl-5-(3-methylbut-1-ynyl)pyrimidin-4-one |
| SMILES | [C-]#[N+]c1ccc(-c2nc(N3CCC(N)CC3)n(C)c(=O)c2C#CC(C)C)cc1F |
| InChI | InChI=1S/C22H24FN5O/c1-14(2)5-7-17-20(15-6-8-19(25-3)18(23)13-15)26-22(27(4)21(17)29)28-11-9-16(24)10-12-28/h6,8,13-14,16H,9-12,24H2,1-2,4H3 |
| InChIKey | ZLSMEXXZKQBXKS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|