C25H23F2N5O — CID 140785024
6-(4-aminopiperidin-1-yl)-3-(4-cyclopropyl-3-fluorophenyl)-2-(3-fluoro-4-isocyanophenyl)pyrimidin-4-one (PubChem CID 140785024) has the molecular formula C25H23F2N5O and a molecular weight of 447.49 g/mol. Its IUPAC name is 6-(4-aminopiperidin-1-yl)-3-(4-cyclopropyl-3-fluorophenyl)-2-(3-fluoro-4-isocyanophenyl)pyrimidin-4-one.
| Compound Name | 6-(4-aminopiperidin-1-yl)-3-(4-cyclopropyl-3-fluorophenyl)-2-(3-fluoro-4-isocyanophenyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 140785024 |
| Molecular Formula | C25H23F2N5O |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 6-(4-aminopiperidin-1-yl)-3-(4-cyclopropyl-3-fluorophenyl)-2-(3-fluoro-4-isocyanophenyl)pyrimidin-4-one |
| SMILES | [C-]#[N+]c1ccc(-c2nc(N3CCC(N)CC3)cc(=O)n2-c2ccc(C3CC3)c(F)c2)cc1F |
| InChI | InChI=1S/C25H23F2N5O/c1-29-22-7-4-16(12-21(22)27)25-30-23(31-10-8-17(28)9-11-31)14-24(33)32(25)18-5-6-19(15-2-3-15)20(26)13-18/h4-7,12-15,17H,2-3,8-11,28H2 |
| InChIKey | ODCUHXKIJWYQSC-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|