C25H22F2N4O2 — CID 140784996
3-(4-cyclopropylphenyl)-5-fluoro-2-(3-fluoro-4-isocyanophenyl)-6-[[(3S)-pyrrolidin-3-yl]methoxy]pyrimidin-4-one (PubChem CID 140784996) has the molecular formula C25H22F2N4O2 and a molecular weight of 448.47 g/mol. Its IUPAC name is 3-(4-cyclopropylphenyl)-5-fluoro-2-(3-fluoro-4-isocyanophenyl)-6-[[(3S)-pyrrolidin-3-yl]methoxy]pyrimidin-4-one.
| Compound Name | 3-(4-cyclopropylphenyl)-5-fluoro-2-(3-fluoro-4-isocyanophenyl)-6-[[(3S)-pyrrolidin-3-yl]methoxy]pyrimidin-4-one |
|---|---|
| PubChem CID | 140784996 |
| Molecular Formula | C25H22F2N4O2 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 3-(4-cyclopropylphenyl)-5-fluoro-2-(3-fluoro-4-isocyanophenyl)-6-[[(3S)-pyrrolidin-3-yl]methoxy]pyrimidin-4-one |
| SMILES | [C-]#[N+]c1ccc(-c2nc(OC[C@H]3CCNC3)c(F)c(=O)n2-c2ccc(C3CC3)cc2)cc1F |
| InChI | InChI=1S/C25H22F2N4O2/c1-28-21-9-6-18(12-20(21)26)23-30-24(33-14-15-10-11-29-13-15)22(27)25(32)31(23)19-7-4-17(5-8-19)16-2-3-16/h4-9,12,15-16,29H,2-3,10-11,13-14H2/t15-/m0/s1 |
| InChIKey | KTPHRECAYLBGRQ-HNNXBMFYSA-N |
| XLogP | 4.59 |
| TPSA | 60.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|