C26H20F3N5 — CID 176622360
6-(2,6-difluorophenyl)-4-(3-fluoro-4-isocyanophenyl)-N-[[(3S)-pyrrolidin-3-yl]methyl]quinazolin-2-amine (PubChem CID 176622360) has the molecular formula C26H20F3N5 and a molecular weight of 459.48 g/mol. Its IUPAC name is 6-(2,6-difluorophenyl)-4-(3-fluoro-4-isocyanophenyl)-N-[[(3S)-pyrrolidin-3-yl]methyl]quinazolin-2-amine.
| Compound Name | 6-(2,6-difluorophenyl)-4-(3-fluoro-4-isocyanophenyl)-N-[[(3S)-pyrrolidin-3-yl]methyl]quinazolin-2-amine |
|---|---|
| PubChem CID | 176622360 |
| Molecular Formula | C26H20F3N5 |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 6-(2,6-difluorophenyl)-4-(3-fluoro-4-isocyanophenyl)-N-[[(3S)-pyrrolidin-3-yl]methyl]quinazolin-2-amine |
| SMILES | [C-]#[N+]c1ccc(-c2nc(NC[C@H]3CCNC3)nc3ccc(-c4c(F)cccc4F)cc23)cc1F |
| InChI | InChI=1S/C26H20F3N5/c1-30-23-8-6-17(12-21(23)29)25-18-11-16(24-19(27)3-2-4-20(24)28)5-7-22(18)33-26(34-25)32-14-15-9-10-31-13-15/h2-8,11-12,15,31H,9-10,13-14H2,(H,32,33,34)/t15-/m0/s1 |
| InChIKey | DDYBZAVSQBROAT-HNNXBMFYSA-N |
| XLogP | 5.95 |
| TPSA | 54.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|