C26H21F2N5O — CID 176622346
2-fluoro-3-[4-(3-fluoro-4-isocyanophenyl)-2-[[(3S)-pyrrolidin-3-yl]methylamino]quinazolin-6-yl]phenol (PubChem CID 176622346) has the molecular formula C26H21F2N5O and a molecular weight of 457.48 g/mol. Its IUPAC name is 2-fluoro-3-[4-(3-fluoro-4-isocyanophenyl)-2-[[(3S)-pyrrolidin-3-yl]methylamino]quinazolin-6-yl]phenol.
| Compound Name | 2-fluoro-3-[4-(3-fluoro-4-isocyanophenyl)-2-[[(3S)-pyrrolidin-3-yl]methylamino]quinazolin-6-yl]phenol |
|---|---|
| PubChem CID | 176622346 |
| Molecular Formula | C26H21F2N5O |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 2-fluoro-3-[4-(3-fluoro-4-isocyanophenyl)-2-[[(3S)-pyrrolidin-3-yl]methylamino]quinazolin-6-yl]phenol |
| SMILES | [C-]#[N+]c1ccc(-c2nc(NC[C@H]3CCNC3)nc3ccc(-c4cccc(O)c4F)cc23)cc1F |
| InChI | InChI=1S/C26H21F2N5O/c1-29-22-8-6-17(12-20(22)27)25-19-11-16(18-3-2-4-23(34)24(18)28)5-7-21(19)32-26(33-25)31-14-15-9-10-30-13-15/h2-8,11-12,15,30,34H,9-10,13-14H2,(H,31,32,33)/t15-/m0/s1 |
| InChIKey | QYFFBOLMHYBSTE-HNNXBMFYSA-N |
| XLogP | 5.52 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|