C28H25FN6 — CID 153493473
5-(1-ethylindazol-5-yl)-4-(3-fluoro-4-isocyanophenyl)-1-[[(3S)-pyrrolidin-3-yl]methyl]pyrrolo[2,3-c]pyridine (PubChem CID 153493473) has the molecular formula C28H25FN6 and a molecular weight of 464.55 g/mol. Its IUPAC name is 5-(1-ethylindazol-5-yl)-4-(3-fluoro-4-isocyanophenyl)-1-[[(3S)-pyrrolidin-3-yl]methyl]pyrrolo[2,3-c]pyridine.
| Compound Name | 5-(1-ethylindazol-5-yl)-4-(3-fluoro-4-isocyanophenyl)-1-[[(3S)-pyrrolidin-3-yl]methyl]pyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 153493473 |
| Molecular Formula | C28H25FN6 |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 5-(1-ethylindazol-5-yl)-4-(3-fluoro-4-isocyanophenyl)-1-[[(3S)-pyrrolidin-3-yl]methyl]pyrrolo[2,3-c]pyridine |
| SMILES | [C-]#[N+]c1ccc(-c2c(-c3ccc4c(cnn4CC)c3)ncc3c2ccn3C[C@H]2CCNC2)cc1F |
| InChI | InChI=1S/C28H25FN6/c1-3-35-25-7-5-20(12-21(25)15-33-35)28-27(19-4-6-24(30-2)23(29)13-19)22-9-11-34(26(22)16-32-28)17-18-8-10-31-14-18/h4-7,9,11-13,15-16,18,31H,3,8,10,14,17H2,1H3/t18-/m0/s1 |
| InChIKey | KFHJAQJRZOFCMW-SFHVURJKSA-N |
| XLogP | 6.04 |
| TPSA | 52.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|