C29H30N4 — CID 153493394
4-(4-isocyanophenyl)-1-(piperidin-4-ylmethyl)-5-(4-propan-2-ylphenyl)pyrrolo[2,3-c]pyridine (PubChem CID 153493394) has the molecular formula C29H30N4 and a molecular weight of 434.59 g/mol. Its IUPAC name is 4-(4-isocyanophenyl)-1-(piperidin-4-ylmethyl)-5-(4-propan-2-ylphenyl)pyrrolo[2,3-c]pyridine.
| Compound Name | 4-(4-isocyanophenyl)-1-(piperidin-4-ylmethyl)-5-(4-propan-2-ylphenyl)pyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 153493394 |
| Molecular Formula | C29H30N4 |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | 4-(4-isocyanophenyl)-1-(piperidin-4-ylmethyl)-5-(4-propan-2-ylphenyl)pyrrolo[2,3-c]pyridine |
| SMILES | [C-]#[N+]c1ccc(-c2c(-c3ccc(C(C)C)cc3)ncc3c2ccn3CC2CCNCC2)cc1 |
| InChI | InChI=1S/C29H30N4/c1-20(2)22-4-6-24(7-5-22)29-28(23-8-10-25(30-3)11-9-23)26-14-17-33(27(26)18-32-29)19-21-12-15-31-16-13-21/h4-11,14,17-18,20-21,31H,12-13,15-16,19H2,1-2H3 |
| InChIKey | RHPAXYTZMMMSNZ-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 34.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|