C27H26N4 — CID 149416554
4-(4-isocyanophenyl)-5-(4-methylphenyl)-1-(piperidin-4-ylmethyl)pyrrolo[2,3-c]pyridine (PubChem CID 149416554) has the molecular formula C27H26N4 and a molecular weight of 406.53 g/mol. Its IUPAC name is 4-(4-isocyanophenyl)-5-(4-methylphenyl)-1-(piperidin-4-ylmethyl)pyrrolo[2,3-c]pyridine.
| Compound Name | 4-(4-isocyanophenyl)-5-(4-methylphenyl)-1-(piperidin-4-ylmethyl)pyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 149416554 |
| Molecular Formula | C27H26N4 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | 4-(4-isocyanophenyl)-5-(4-methylphenyl)-1-(piperidin-4-ylmethyl)pyrrolo[2,3-c]pyridine |
| SMILES | [C-]#[N+]c1ccc(-c2c(-c3ccc(C)cc3)ncc3c2ccn3CC2CCNCC2)cc1 |
| InChI | InChI=1S/C27H26N4/c1-19-3-5-22(6-4-19)27-26(21-7-9-23(28-2)10-8-21)24-13-16-31(25(24)17-30-27)18-20-11-14-29-15-12-20/h3-10,13,16-17,20,29H,11-12,14-15,18H2,1H3 |
| InChIKey | YSHGMFOTBRHMPQ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 34.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|