C28H26N4O — CID 161082616
1-[4-[4-(4-isocyanophenyl)-1-[[(3R)-pyrrolidin-3-yl]methyl]pyrrolo[2,3-c]pyridin-5-yl]phenyl]propan-1-one (PubChem CID 161082616) has the molecular formula C28H26N4O and a molecular weight of 434.54 g/mol. Its IUPAC name is 1-[4-[4-(4-isocyanophenyl)-1-[[(3R)-pyrrolidin-3-yl]methyl]pyrrolo[2,3-c]pyridin-5-yl]phenyl]propan-1-one.
| Compound Name | 1-[4-[4-(4-isocyanophenyl)-1-[[(3R)-pyrrolidin-3-yl]methyl]pyrrolo[2,3-c]pyridin-5-yl]phenyl]propan-1-one |
|---|---|
| PubChem CID | 161082616 |
| Molecular Formula | C28H26N4O |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 1-[4-[4-(4-isocyanophenyl)-1-[[(3R)-pyrrolidin-3-yl]methyl]pyrrolo[2,3-c]pyridin-5-yl]phenyl]propan-1-one |
| SMILES | [C-]#[N+]c1ccc(-c2c(-c3ccc(C(=O)CC)cc3)ncc3c2ccn3C[C@@H]2CCNC2)cc1 |
| InChI | InChI=1S/C28H26N4O/c1-3-26(33)20-4-6-22(7-5-20)28-27(21-8-10-23(29-2)11-9-21)24-13-15-32(25(24)17-31-28)18-19-12-14-30-16-19/h4-11,13,15,17,19,30H,3,12,14,16,18H2,1H3/t19-/m1/s1 |
| InChIKey | UGCIWVPWZMNSCS-LJQANCHMSA-N |
| XLogP | 6.12 |
| TPSA | 51.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|