C29H30N4O — CID 153493393
2-[4-[4-(4-isocyanophenyl)-1-(piperidin-4-ylmethyl)pyrrolo[2,3-c]pyridin-5-yl]phenyl]propan-2-ol (PubChem CID 153493393) has the molecular formula C29H30N4O and a molecular weight of 450.59 g/mol. Its IUPAC name is 2-[4-[4-(4-isocyanophenyl)-1-(piperidin-4-ylmethyl)pyrrolo[2,3-c]pyridin-5-yl]phenyl]propan-2-ol.
| Compound Name | 2-[4-[4-(4-isocyanophenyl)-1-(piperidin-4-ylmethyl)pyrrolo[2,3-c]pyridin-5-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 153493393 |
| Molecular Formula | C29H30N4O |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | 2-[4-[4-(4-isocyanophenyl)-1-(piperidin-4-ylmethyl)pyrrolo[2,3-c]pyridin-5-yl]phenyl]propan-2-ol |
| SMILES | [C-]#[N+]c1ccc(-c2c(-c3ccc(C(C)(C)O)cc3)ncc3c2ccn3CC2CCNCC2)cc1 |
| InChI | InChI=1S/C29H30N4O/c1-29(2,34)23-8-4-22(5-9-23)28-27(21-6-10-24(30-3)11-7-21)25-14-17-33(26(25)18-32-28)19-20-12-15-31-16-13-20/h4-11,14,17-18,20,31,34H,12-13,15-16,19H2,1-2H3 |
| InChIKey | AEIBKZPCSLJARY-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 54.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|