C27H23FN6 — CID 153493379
4-(2-fluoro-4-isocyanophenyl)-5-(1-methylindazol-5-yl)-1-[[(3R)-pyrrolidin-3-yl]methyl]pyrrolo[2,3-c]pyridine (PubChem CID 153493379) has the molecular formula C27H23FN6 and a molecular weight of 450.52 g/mol. Its IUPAC name is 4-(2-fluoro-4-isocyanophenyl)-5-(1-methylindazol-5-yl)-1-[[(3R)-pyrrolidin-3-yl]methyl]pyrrolo[2,3-c]pyridine.
| Compound Name | 4-(2-fluoro-4-isocyanophenyl)-5-(1-methylindazol-5-yl)-1-[[(3R)-pyrrolidin-3-yl]methyl]pyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 153493379 |
| Molecular Formula | C27H23FN6 |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 4-(2-fluoro-4-isocyanophenyl)-5-(1-methylindazol-5-yl)-1-[[(3R)-pyrrolidin-3-yl]methyl]pyrrolo[2,3-c]pyridine |
| SMILES | [C-]#[N+]c1ccc(-c2c(-c3ccc4c(cnn4C)c3)ncc3c2ccn3C[C@@H]2CCNC2)c(F)c1 |
| InChI | InChI=1S/C27H23FN6/c1-29-20-4-5-21(23(28)12-20)26-22-8-10-34(16-17-7-9-30-13-17)25(22)15-31-27(26)18-3-6-24-19(11-18)14-32-33(24)2/h3-6,8,10-12,14-15,17,30H,7,9,13,16H2,2H3/t17-/m1/s1 |
| InChIKey | QNQPNWIUJQEMPI-QGZVFWFLSA-N |
| XLogP | 5.56 |
| TPSA | 52.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|