C26H25N5 — CID 153493456
4-[4-(4-isocyanophenyl)-1-(piperidin-4-ylmethyl)pyrrolo[2,3-c]pyridin-5-yl]aniline (PubChem CID 153493456) has the molecular formula C26H25N5 and a molecular weight of 407.52 g/mol. Its IUPAC name is 4-[4-(4-isocyanophenyl)-1-(piperidin-4-ylmethyl)pyrrolo[2,3-c]pyridin-5-yl]aniline.
| Compound Name | 4-[4-(4-isocyanophenyl)-1-(piperidin-4-ylmethyl)pyrrolo[2,3-c]pyridin-5-yl]aniline |
|---|---|
| PubChem CID | 153493456 |
| Molecular Formula | C26H25N5 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 4-[4-(4-isocyanophenyl)-1-(piperidin-4-ylmethyl)pyrrolo[2,3-c]pyridin-5-yl]aniline |
| SMILES | [C-]#[N+]c1ccc(-c2c(-c3ccc(N)cc3)ncc3c2ccn3CC2CCNCC2)cc1 |
| InChI | InChI=1S/C26H25N5/c1-28-22-8-4-19(5-9-22)25-23-12-15-31(17-18-10-13-29-14-11-18)24(23)16-30-26(25)20-2-6-21(27)7-3-20/h2-9,12,15-16,18,29H,10-11,13-14,17,27H2 |
| InChIKey | RCJJUKNUQAYCDJ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 60.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|