C26H25FN6O — CID 140785018
6-(1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,4-c]pyridin-5-yl)-3-(6-cyclopropyl-3-pyridinyl)-2-(3-fluoro-4-isocyanophenyl)pyrimidin-4-one (PubChem CID 140785018) has the molecular formula C26H25FN6O and a molecular weight of 456.53 g/mol. Its IUPAC name is 6-(1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,4-c]pyridin-5-yl)-3-(6-cyclopropyl-3-pyridinyl)-2-(3-fluoro-4-isocyanophenyl)pyrimidin-4-one.
| Compound Name | 6-(1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,4-c]pyridin-5-yl)-3-(6-cyclopropyl-3-pyridinyl)-2-(3-fluoro-4-isocyanophenyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 140785018 |
| Molecular Formula | C26H25FN6O |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | 6-(1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,4-c]pyridin-5-yl)-3-(6-cyclopropyl-3-pyridinyl)-2-(3-fluoro-4-isocyanophenyl)pyrimidin-4-one |
| SMILES | [C-]#[N+]c1ccc(-c2nc(N3CCC4CNCC4C3)cc(=O)n2-c2ccc(C3CC3)nc2)cc1F |
| InChI | InChI=1S/C26H25FN6O/c1-28-23-6-4-17(10-21(23)27)26-31-24(32-9-8-18-12-29-13-19(18)15-32)11-25(34)33(26)20-5-7-22(30-14-20)16-2-3-16/h4-7,10-11,14,16,18-19,29H,2-3,8-9,12-13,15H2 |
| InChIKey | WUMKDWCUADUQQV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 67.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|