C24H21ClF2N4O2 — CID 159050001
5-chloro-2-(3-fluoro-4-isocyanophenyl)-3-(3-fluoro-4-methoxyphenyl)-6-(4-methylpiperidin-1-yl)pyrimidin-4-one (PubChem CID 159050001) has the molecular formula C24H21ClF2N4O2 and a molecular weight of 470.91 g/mol. Its IUPAC name is 5-chloro-2-(3-fluoro-4-isocyanophenyl)-3-(3-fluoro-4-methoxyphenyl)-6-(4-methylpiperidin-1-yl)pyrimidin-4-one.
| Compound Name | 5-chloro-2-(3-fluoro-4-isocyanophenyl)-3-(3-fluoro-4-methoxyphenyl)-6-(4-methylpiperidin-1-yl)pyrimidin-4-one |
|---|---|
| PubChem CID | 159050001 |
| Molecular Formula | C24H21ClF2N4O2 |
| Molecular Weight | 470.91 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 5-chloro-2-(3-fluoro-4-isocyanophenyl)-3-(3-fluoro-4-methoxyphenyl)-6-(4-methylpiperidin-1-yl)pyrimidin-4-one |
| SMILES | [C-]#[N+]c1ccc(-c2nc(N3CCC(C)CC3)c(Cl)c(=O)n2-c2ccc(OC)c(F)c2)cc1F |
| InChI | InChI=1S/C24H21ClF2N4O2/c1-14-8-10-30(11-9-14)23-21(25)24(32)31(16-5-7-20(33-3)18(27)13-16)22(29-23)15-4-6-19(28-2)17(26)12-15/h4-7,12-14H,8-11H2,1,3H3 |
| InChIKey | QAMRFANOAWQWJU-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 51.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.91 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|