C25H23FN6O — CID 162189948
2-(3-fluoro-4-isocyanophenyl)-3-(1-methylindazol-5-yl)-6-(4-methylpiperidin-1-yl)pyrimidin-4-one (PubChem CID 162189948) has the molecular formula C25H23FN6O and a molecular weight of 442.50 g/mol. Its IUPAC name is 2-(3-fluoro-4-isocyanophenyl)-3-(1-methylindazol-5-yl)-6-(4-methylpiperidin-1-yl)pyrimidin-4-one.
| Compound Name | 2-(3-fluoro-4-isocyanophenyl)-3-(1-methylindazol-5-yl)-6-(4-methylpiperidin-1-yl)pyrimidin-4-one |
|---|---|
| PubChem CID | 162189948 |
| Molecular Formula | C25H23FN6O |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 2-(3-fluoro-4-isocyanophenyl)-3-(1-methylindazol-5-yl)-6-(4-methylpiperidin-1-yl)pyrimidin-4-one |
| SMILES | [C-]#[N+]c1ccc(-c2nc(N3CCC(C)CC3)cc(=O)n2-c2ccc3c(cnn3C)c2)cc1F |
| InChI | InChI=1S/C25H23FN6O/c1-16-8-10-31(11-9-16)23-14-24(33)32(19-5-7-22-18(12-19)15-28-30(22)3)25(29-23)17-4-6-21(27-2)20(26)13-17/h4-7,12-16H,8-11H2,1,3H3 |
| InChIKey | UMEAUDCAEIVRBS-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 60.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|