C25H24FN7O — CID 163821170
1-[(3R)-3-aminopiperidin-1-yl]-2-[3-(3-fluoro-4-isocyanophenyl)-4-(1-methylindazol-5-yl)pyrazol-1-yl]ethanone (PubChem CID 163821170) has the molecular formula C25H24FN7O and a molecular weight of 457.51 g/mol. Its IUPAC name is 1-[(3R)-3-aminopiperidin-1-yl]-2-[3-(3-fluoro-4-isocyanophenyl)-4-(1-methylindazol-5-yl)pyrazol-1-yl]ethanone.
| Compound Name | 1-[(3R)-3-aminopiperidin-1-yl]-2-[3-(3-fluoro-4-isocyanophenyl)-4-(1-methylindazol-5-yl)pyrazol-1-yl]ethanone |
|---|---|
| PubChem CID | 163821170 |
| Molecular Formula | C25H24FN7O |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 1-[(3R)-3-aminopiperidin-1-yl]-2-[3-(3-fluoro-4-isocyanophenyl)-4-(1-methylindazol-5-yl)pyrazol-1-yl]ethanone |
| SMILES | [C-]#[N+]c1ccc(-c2nn(CC(=O)N3CCC[C@@H](N)C3)cc2-c2ccc3c(cnn3C)c2)cc1F |
| InChI | InChI=1S/C25H24FN7O/c1-28-22-7-5-17(11-21(22)26)25-20(16-6-8-23-18(10-16)12-29-31(23)2)14-33(30-25)15-24(34)32-9-3-4-19(27)13-32/h5-8,10-12,14,19H,3-4,9,13,15,27H2,2H3/t19-/m1/s1 |
| InChIKey | NVNGMBJYRHZPQL-LJQANCHMSA-N |
| XLogP | 3.74 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|