C23H21F2N5O2 — CID 163725775
1-[(3S)-3-aminopyrrolidin-1-yl]-2-[3-(3-fluoro-4-isocyanophenyl)-4-(3-fluoro-4-methoxyphenyl)pyrazol-1-yl]ethanone (PubChem CID 163725775) has the molecular formula C23H21F2N5O2 and a molecular weight of 437.45 g/mol. Its IUPAC name is 1-[(3S)-3-aminopyrrolidin-1-yl]-2-[3-(3-fluoro-4-isocyanophenyl)-4-(3-fluoro-4-methoxyphenyl)pyrazol-1-yl]ethanone.
| Compound Name | 1-[(3S)-3-aminopyrrolidin-1-yl]-2-[3-(3-fluoro-4-isocyanophenyl)-4-(3-fluoro-4-methoxyphenyl)pyrazol-1-yl]ethanone |
|---|---|
| PubChem CID | 163725775 |
| Molecular Formula | C23H21F2N5O2 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 1-[(3S)-3-aminopyrrolidin-1-yl]-2-[3-(3-fluoro-4-isocyanophenyl)-4-(3-fluoro-4-methoxyphenyl)pyrazol-1-yl]ethanone |
| SMILES | [C-]#[N+]c1ccc(-c2nn(CC(=O)N3CC[C@H](N)C3)cc2-c2ccc(OC)c(F)c2)cc1F |
| InChI | InChI=1S/C23H21F2N5O2/c1-27-20-5-3-15(10-18(20)24)23-17(14-4-6-21(32-2)19(25)9-14)12-30(28-23)13-22(31)29-8-7-16(26)11-29/h3-6,9-10,12,16H,7-8,11,13,26H2,2H3/t16-/m0/s1 |
| InChIKey | KVLFJEUUAHHOOM-INIZCTEOSA-N |
| XLogP | 3.61 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|