C28H30FN5O3 — CID 140909983
4-[5-[(3R)-3-aminopiperidine-1-carbonyl]-3-(3-fluoro-4-isocyanophenyl)-2-(4-methoxyphenyl)pyrrol-1-yl]butanamide (PubChem CID 140909983) has the molecular formula C28H30FN5O3 and a molecular weight of 503.58 g/mol. Its IUPAC name is 4-[5-[(3R)-3-aminopiperidine-1-carbonyl]-3-(3-fluoro-4-isocyanophenyl)-2-(4-methoxyphenyl)pyrrol-1-yl]butanamide.
| Compound Name | 4-[5-[(3R)-3-aminopiperidine-1-carbonyl]-3-(3-fluoro-4-isocyanophenyl)-2-(4-methoxyphenyl)pyrrol-1-yl]butanamide |
|---|---|
| PubChem CID | 140909983 |
| Molecular Formula | C28H30FN5O3 |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | 4-[5-[(3R)-3-aminopiperidine-1-carbonyl]-3-(3-fluoro-4-isocyanophenyl)-2-(4-methoxyphenyl)pyrrol-1-yl]butanamide |
| SMILES | [C-]#[N+]c1ccc(-c2cc(C(=O)N3CCC[C@@H](N)C3)n(CCCC(N)=O)c2-c2ccc(OC)cc2)cc1F |
| InChI | InChI=1S/C28H30FN5O3/c1-32-24-12-9-19(15-23(24)29)22-16-25(28(36)33-13-3-5-20(30)17-33)34(14-4-6-26(31)35)27(22)18-7-10-21(37-2)11-8-18/h7-12,15-16,20H,3-6,13-14,17,30H2,2H3,(H2,31,35)/t20-/m1/s1 |
| InChIKey | SZYWTYPHDCHTMN-HXUWFJFHSA-N |
| XLogP | 4.35 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|