C25H22F2N6O — CID 170533953
(3R)-1-[2-(3-fluoro-4-isocyanophenyl)-3-(3-fluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]piperidin-3-amine (PubChem CID 170533953) has the molecular formula C25H22F2N6O and a molecular weight of 460.49 g/mol. Its IUPAC name is (3R)-1-[2-(3-fluoro-4-isocyanophenyl)-3-(3-fluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]piperidin-3-amine.
| Compound Name | (3R)-1-[2-(3-fluoro-4-isocyanophenyl)-3-(3-fluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]piperidin-3-amine |
|---|---|
| PubChem CID | 170533953 |
| Molecular Formula | C25H22F2N6O |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | (3R)-1-[2-(3-fluoro-4-isocyanophenyl)-3-(3-fluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]piperidin-3-amine |
| SMILES | [C-]#[N+]c1ccc(-c2nc3c(N4CCC[C@@H](N)C4)nccn3c2-c2ccc(OC)c(F)c2)cc1F |
| InChI | InChI=1S/C25H22F2N6O/c1-29-20-7-5-15(12-18(20)26)22-23(16-6-8-21(34-2)19(27)13-16)33-11-9-30-24(25(33)31-22)32-10-3-4-17(28)14-32/h5-9,11-13,17H,3-4,10,14,28H2,2H3/t17-/m1/s1 |
| InChIKey | JWIOVQRDAXJEBW-QGZVFWFLSA-N |
| XLogP | 4.83 |
| TPSA | 73.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|