C27H25FN4O — CID 175215229
4-[5-(3-aminopiperidin-1-yl)-2-(3-fluoro-4-methoxyphenyl)indol-1-yl]benzonitrile (PubChem CID 175215229) has the molecular formula C27H25FN4O and a molecular weight of 440.52 g/mol. Its IUPAC name is 4-[5-(3-aminopiperidin-1-yl)-2-(3-fluoro-4-methoxyphenyl)indol-1-yl]benzonitrile.
| Compound Name | 4-[5-(3-aminopiperidin-1-yl)-2-(3-fluoro-4-methoxyphenyl)indol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 175215229 |
| Molecular Formula | C27H25FN4O |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 4-[5-(3-aminopiperidin-1-yl)-2-(3-fluoro-4-methoxyphenyl)indol-1-yl]benzonitrile |
| SMILES | COc1ccc(-c2cc3cc(N4CCCC(N)C4)ccc3n2-c2ccc(C#N)cc2)cc1F |
| InChI | InChI=1S/C27H25FN4O/c1-33-27-11-6-19(14-24(27)28)26-15-20-13-23(31-12-2-3-21(30)17-31)9-10-25(20)32(26)22-7-4-18(16-29)5-8-22/h4-11,13-15,21H,2-3,12,17,30H2,1H3 |
| InChIKey | BQPHAJYMGWPUEJ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 67.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |