C27H24FN5O — CID 168865945
4-[2-(4-aminopiperidin-1-yl)-6-(3-fluoro-4-methoxyphenyl)quinazolin-4-yl]benzonitrile (PubChem CID 168865945) has the molecular formula C27H24FN5O and a molecular weight of 453.52 g/mol. Its IUPAC name is 4-[2-(4-aminopiperidin-1-yl)-6-(3-fluoro-4-methoxyphenyl)quinazolin-4-yl]benzonitrile.
| Compound Name | 4-[2-(4-aminopiperidin-1-yl)-6-(3-fluoro-4-methoxyphenyl)quinazolin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 168865945 |
| Molecular Formula | C27H24FN5O |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | 4-[2-(4-aminopiperidin-1-yl)-6-(3-fluoro-4-methoxyphenyl)quinazolin-4-yl]benzonitrile |
| SMILES | COc1ccc(-c2ccc3nc(N4CCC(N)CC4)nc(-c4ccc(C#N)cc4)c3c2)cc1F |
| InChI | InChI=1S/C27H24FN5O/c1-34-25-9-7-20(15-23(25)28)19-6-8-24-22(14-19)26(18-4-2-17(16-29)3-5-18)32-27(31-24)33-12-10-21(30)11-13-33/h2-9,14-15,21H,10-13,30H2,1H3 |
| InChIKey | FDZMDPLFXVVGAF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 88.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |