C23H20FN7O — CID 140910059
[(3S)-3-aminopyrrolidin-1-yl]-[2-(3-fluoro-4-isocyanophenyl)-1-(2-methylindazol-6-yl)imidazol-4-yl]methanone (PubChem CID 140910059) has the molecular formula C23H20FN7O and a molecular weight of 429.46 g/mol. Its IUPAC name is [(3S)-3-aminopyrrolidin-1-yl]-[2-(3-fluoro-4-isocyanophenyl)-1-(2-methylindazol-6-yl)imidazol-4-yl]methanone.
| Compound Name | [(3S)-3-aminopyrrolidin-1-yl]-[2-(3-fluoro-4-isocyanophenyl)-1-(2-methylindazol-6-yl)imidazol-4-yl]methanone |
|---|---|
| PubChem CID | 140910059 |
| Molecular Formula | C23H20FN7O |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | [(3S)-3-aminopyrrolidin-1-yl]-[2-(3-fluoro-4-isocyanophenyl)-1-(2-methylindazol-6-yl)imidazol-4-yl]methanone |
| SMILES | [C-]#[N+]c1ccc(-c2nc(C(=O)N3CC[C@H](N)C3)cn2-c2ccc3cn(C)nc3c2)cc1F |
| InChI | InChI=1S/C23H20FN7O/c1-26-19-6-4-14(9-18(19)24)22-27-21(23(32)30-8-7-16(25)12-30)13-31(22)17-5-3-15-11-29(2)28-20(15)10-17/h3-6,9-11,13,16H,7-8,12,25H2,2H3/t16-/m0/s1 |
| InChIKey | VGIJZRBKELCEGD-INIZCTEOSA-N |
| XLogP | 3.29 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|