C27H27FN4O2S — CID 171735272
[(3R)-3-aminopiperidin-1-yl]-[4-(3-fluoro-4-isocyanophenyl)-5-[4-(3-hydroxypyrrolidin-1-yl)phenyl]thiophen-2-yl]methanone (PubChem CID 171735272) has the molecular formula C27H27FN4O2S and a molecular weight of 490.60 g/mol. Its IUPAC name is [(3R)-3-aminopiperidin-1-yl]-[4-(3-fluoro-4-isocyanophenyl)-5-[4-(3-hydroxypyrrolidin-1-yl)phenyl]thiophen-2-yl]methanone.
| Compound Name | [(3R)-3-aminopiperidin-1-yl]-[4-(3-fluoro-4-isocyanophenyl)-5-[4-(3-hydroxypyrrolidin-1-yl)phenyl]thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 171735272 |
| Molecular Formula | C27H27FN4O2S |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | [(3R)-3-aminopiperidin-1-yl]-[4-(3-fluoro-4-isocyanophenyl)-5-[4-(3-hydroxypyrrolidin-1-yl)phenyl]thiophen-2-yl]methanone |
| SMILES | [C-]#[N+]c1ccc(-c2cc(C(=O)N3CCC[C@@H](N)C3)sc2-c2ccc(N3CCC(O)C3)cc2)cc1F |
| InChI | InChI=1S/C27H27FN4O2S/c1-30-24-9-6-18(13-23(24)28)22-14-25(27(34)32-11-2-3-19(29)15-32)35-26(22)17-4-7-20(8-5-17)31-12-10-21(33)16-31/h4-9,13-14,19,21,33H,2-3,10-12,15-16,29H2/t19-,21?/m1/s1 |
| InChIKey | LAKGGWSEISHGPV-YMBRHYMPSA-N |
| XLogP | 4.91 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|